C20H18N2O5 — CID 55460240
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-methoxy-4-prop-2-enoxybenzoate (PubChem CID 55460240) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-methoxy-4-prop-2-enoxybenzoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-methoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 55460240 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-methoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCc2cc(=O)n3ccccc3n2)cc1OC |
| InChI | InChI=1S/C20H18N2O5/c1-3-10-26-16-8-7-14(11-17(16)25-2)20(24)27-13-15-12-19(23)22-9-5-4-6-18(22)21-15/h3-9,11-12H,1,10,13H2,2H3 |
| InChIKey | FOXVWYFMUROQBF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|