C19H19Cl2NO2 — CID 55460870
(2,3-dichlorophenyl)-(4-phenylmethoxypiperidin-1-yl)methanone (PubChem CID 55460870) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(4-phenylmethoxypiperidin-1-yl)methanone.
| Compound Name | (2,3-dichlorophenyl)-(4-phenylmethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55460870 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (2,3-dichlorophenyl)-(4-phenylmethoxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19Cl2NO2/c20-17-8-4-7-16(18(17)21)19(23)22-11-9-15(10-12-22)24-13-14-5-2-1-3-6-14/h1-8,15H,9-13H2 |
| InChIKey | APFFXUBXXFZKFB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |