C20H18F2N2O5S — CID 55463952
[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 55463952) has the molecular formula C20H18F2N2O5S and a molecular weight of 436.44 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55463952 |
| Molecular Formula | C20H18F2N2O5S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1c[nH]c2ccccc12)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C20H18F2N2O5S/c21-20(22)30(27,28)15-8-6-14(7-9-15)24-18(25)12-29-19(26)10-5-13-11-23-17-4-2-1-3-16(13)17/h1-4,6-9,11,20,23H,5,10,12H2,(H,24,25) |
| InChIKey | DMBCRXLRPNVDSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |