C19H22ClN3O5S — CID 55464238
3-chloro-N'-[2-(4-morpholin-4-ylsulfonylphenoxy)ethoxy]benzenecarboximidamide (PubChem CID 55464238) has the molecular formula C19H22ClN3O5S and a molecular weight of 439.92 g/mol. Its IUPAC name is 3-chloro-N'-[2-(4-morpholin-4-ylsulfonylphenoxy)ethoxy]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-[2-(4-morpholin-4-ylsulfonylphenoxy)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 55464238 |
| Molecular Formula | C19H22ClN3O5S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-chloro-N'-[2-(4-morpholin-4-ylsulfonylphenoxy)ethoxy]benzenecarboximidamide |
| SMILES | N/C(=N/OCCOc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O5S/c20-16-3-1-2-15(14-16)19(21)22-28-13-12-27-17-4-6-18(7-5-17)29(24,25)23-8-10-26-11-9-23/h1-7,14H,8-13H2,(H2,21,22) |
| InChIKey | UUFSJYYRPYZSPV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|