C20H18BrClFN3O2 — CID 55464560
4-bromo-1-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indole-2,3-dione (PubChem CID 55464560) has the molecular formula C20H18BrClFN3O2 and a molecular weight of 466.74 g/mol. Its IUPAC name is 4-bromo-1-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indole-2,3-dione.
| Compound Name | 4-bromo-1-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 55464560 |
| Molecular Formula | C20H18BrClFN3O2 |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 4-bromo-1-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(Cc3c(F)cccc3Cl)CC2)c2cccc(Br)c21 |
| InChI | InChI=1S/C20H18BrClFN3O2/c21-14-3-1-6-17-18(14)19(27)20(28)26(17)12-25-9-7-24(8-10-25)11-13-15(22)4-2-5-16(13)23/h1-6H,7-12H2 |
| InChIKey | FMRHHHLYGWJCED-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|