C24H30N2O5S — CID 55464674
N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carbohydrazide (PubChem CID 55464674) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 55464674 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carbohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)C2(S(=O)(=O)c3cc(C)ccc3C)CCCC2)c1 |
| InChI | InChI=1S/C24H30N2O5S/c1-16-7-9-18(3)20(13-16)31-15-22(27)25-26-23(28)24(11-5-6-12-24)32(29,30)21-14-17(2)8-10-19(21)4/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | LHIYEUFVDHUNCV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|