C21H17F3N2O6 — CID 55465175
[2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55465175) has the molecular formula C21H17F3N2O6 and a molecular weight of 450.37 g/mol. Its IUPAC name is [2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55465175 |
| Molecular Formula | C21H17F3N2O6 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)c2ccccc2C1=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C21H17F3N2O6/c22-21(23,24)32-16-8-4-1-5-13(16)11-25-17(27)12-31-18(28)9-10-26-19(29)14-6-2-3-7-15(14)20(26)30/h1-8H,9-12H2,(H,25,27) |
| InChIKey | ZPJVZEKRULIGFB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|