C21H19Cl2N3O3S — CID 55465626
N-(4-amino-3,5-dichlorophenyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 55465626) has the molecular formula C21H19Cl2N3O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55465626 |
| Molecular Formula | C21H19Cl2N3O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C)c(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H19Cl2N3O3S/c1-12-7-8-15(30(28,29)26-19-6-4-3-5-13(19)2)11-16(12)21(27)25-14-9-17(22)20(24)18(23)10-14/h3-11,26H,24H2,1-2H3,(H,25,27) |
| InChIKey | UHIOQDAJTRFEKI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|