C21H24ClN5O3 — CID 55467477
N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55467477) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55467477 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)-5-methylpyrazol-3-yl]-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C21H24ClN5O3/c1-14-11-17(27(24-14)16-8-6-7-15(22)12-16)23-18(28)13-26-19(29)21(25(2)20(26)30)9-4-3-5-10-21/h6-8,11-12H,3-5,9-10,13H2,1-2H3,(H,23,28) |
| InChIKey | CLHCCADSOICYOO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|