C19H21NO5S2 — CID 55467782
ethyl 3-methyl-5-[[2-(2-phenylsulfanylpropanoyloxy)acetyl]amino]thiophene-2-carboxylate (PubChem CID 55467782) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[2-(2-phenylsulfanylpropanoyloxy)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[2-(2-phenylsulfanylpropanoyloxy)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55467782 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 3-methyl-5-[[2-(2-phenylsulfanylpropanoyloxy)acetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)C(C)Sc2ccccc2)cc1C |
| InChI | InChI=1S/C19H21NO5S2/c1-4-24-19(23)17-12(2)10-16(27-17)20-15(21)11-25-18(22)13(3)26-14-8-6-5-7-9-14/h5-10,13H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | WFYKMBXUFNQSEZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |