C16H16BrNO4S — CID 7942305
ethyl 5-[[2-(3-bromophenoxy)acetyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 7942305) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is ethyl 5-[[2-(3-bromophenoxy)acetyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[2-(3-bromophenoxy)acetyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7942305 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | ethyl 5-[[2-(3-bromophenoxy)acetyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COc2cccc(Br)c2)cc1C |
| InChI | InChI=1S/C16H16BrNO4S/c1-3-21-16(20)15-10(2)7-14(23-15)18-13(19)9-22-12-6-4-5-11(17)8-12/h4-8H,3,9H2,1-2H3,(H,18,19) |
| InChIKey | DJQZEEZNQABLNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |