C18H19ClN2O4 — CID 55468348
5-chloro-2-hydroxy-N'-[3-[5-(2-methylcyclopropyl)furan-2-yl]propanoyl]benzohydrazide (PubChem CID 55468348) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N'-[3-[5-(2-methylcyclopropyl)furan-2-yl]propanoyl]benzohydrazide.
| Compound Name | 5-chloro-2-hydroxy-N'-[3-[5-(2-methylcyclopropyl)furan-2-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 55468348 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-chloro-2-hydroxy-N'-[3-[5-(2-methylcyclopropyl)furan-2-yl]propanoyl]benzohydrazide |
| SMILES | CC1CC1c1ccc(CCC(=O)NNC(=O)c2cc(Cl)ccc2O)o1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-10-8-13(10)16-6-3-12(25-16)4-7-17(23)20-21-18(24)14-9-11(19)2-5-15(14)22/h2-3,5-6,9-10,13,22H,4,7-8H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HTOSVFCYFUVQNU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|