C18H20N2O4 — CID 97023104
3-hydroxy-N'-[3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]propanoyl]benzohydrazide (PubChem CID 97023104) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-hydroxy-N'-[3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]propanoyl]benzohydrazide.
| Compound Name | 3-hydroxy-N'-[3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 97023104 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-hydroxy-N'-[3-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]propanoyl]benzohydrazide |
| SMILES | C[C@H]1C[C@@H]1c1ccc(CCC(=O)NNC(=O)c2cccc(O)c2)o1 |
| InChI | InChI=1S/C18H20N2O4/c1-11-9-15(11)16-7-5-14(24-16)6-8-17(22)19-20-18(23)12-3-2-4-13(21)10-12/h2-5,7,10-11,15,21H,6,8-9H2,1H3,(H,19,22)(H,20,23)/t11-,15-/m0/s1 |
| InChIKey | SETOCIGDGQRTFG-NHYWBVRUSA-N |
| XLogP | 2.50 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|