C23H33N5O3S — CID 55469758
N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]acetamide (PubChem CID 55469758) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]acetamide.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 55469758 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]-2-[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]acetamide |
| SMILES | Cc1cc(NC(=O)CN(C)Cc2ccc(N3CCCCC3)cc2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C23H33N5O3S/c1-18-14-22(28(25-18)21-10-13-32(30,31)17-21)24-23(29)16-26(2)15-19-6-8-20(9-7-19)27-11-4-3-5-12-27/h6-9,14,21H,3-5,10-13,15-17H2,1-2H3,(H,24,29) |
| InChIKey | JALRIOQDVWZDHF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|