C24H28N4O3S — CID 75864752
2-(dibenzylamino)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]acetamide (PubChem CID 75864752) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-(dibenzylamino)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]acetamide.
| Compound Name | 2-(dibenzylamino)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 75864752 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-(dibenzylamino)-N-[2-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-3-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN(Cc2ccccc2)Cc2ccccc2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C24H28N4O3S/c1-19-14-23(28(26-19)22-12-13-32(30,31)18-22)25-24(29)17-27(15-20-8-4-2-5-9-20)16-21-10-6-3-7-11-21/h2-11,14,22H,12-13,15-18H2,1H3,(H,25,29) |
| InChIKey | IKMYSXJRMQRGAR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |