C18H20N4O3S — CID 52521217
N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-2-indol-1-ylacetamide (PubChem CID 52521217) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-2-indol-1-ylacetamide.
| Compound Name | N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-2-indol-1-ylacetamide |
|---|---|
| PubChem CID | 52521217 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]-2-indol-1-ylacetamide |
| SMILES | Cc1cc(NC(=O)Cn2ccc3ccccc32)n([C@@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C18H20N4O3S/c1-13-10-17(22(20-13)15-7-9-26(24,25)12-15)19-18(23)11-21-8-6-14-4-2-3-5-16(14)21/h2-6,8,10,15H,7,9,11-12H2,1H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | VMNDEBIBZPIZOY-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |