C16H18Cl2N4O3S — CID 39974928
2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]acetamide (PubChem CID 39974928) has the molecular formula C16H18Cl2N4O3S and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]acetamide.
| Compound Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 39974928 |
| Molecular Formula | C16H18Cl2N4O3S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-[(3R)-1,1-dioxothiolan-3-yl]-5-methylpyrazol-3-yl]acetamide |
| SMILES | Cc1cc(Cl)c(CC(=O)Nc2cc(C)nn2[C@@H]2CCS(=O)(=O)C2)c(Cl)n1 |
| InChI | InChI=1S/C16H18Cl2N4O3S/c1-9-5-13(17)12(16(18)19-9)7-15(23)20-14-6-10(2)21-22(14)11-3-4-26(24,25)8-11/h5-6,11H,3-4,7-8H2,1-2H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | MUOYHWDKWRNSDV-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|