C21H18Cl2N2O4S2 — CID 55471554
3-[(2,5-dichlorophenyl)sulfanylmethyl]-N-(2-methoxy-5-sulfamoylphenyl)benzamide (PubChem CID 55471554) has the molecular formula C21H18Cl2N2O4S2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfanylmethyl]-N-(2-methoxy-5-sulfamoylphenyl)benzamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfanylmethyl]-N-(2-methoxy-5-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 55471554 |
| Molecular Formula | C21H18Cl2N2O4S2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfanylmethyl]-N-(2-methoxy-5-sulfamoylphenyl)benzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC(=O)c1cccc(CSc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N2O4S2/c1-29-19-8-6-16(31(24,27)28)11-18(19)25-21(26)14-4-2-3-13(9-14)12-30-20-10-15(22)5-7-17(20)23/h2-11H,12H2,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | DTZCQJNSESOGNO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |