C25H30N4O5 — CID 55471576
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate (PubChem CID 55471576) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 55471576 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate |
| SMILES | CCn1c(=O)n(CCC(=O)OCC(=O)N2CCN(c3ccc(OC)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H30N4O5/c1-3-28-21-6-4-5-7-22(21)29(25(28)32)13-12-24(31)34-18-23(30)27-16-14-26(15-17-27)19-8-10-20(33-2)11-9-19/h4-11H,3,12-18H2,1-2H3 |
| InChIKey | WBMDTVRZVIXNMO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|