About [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate (PubChem CID 7990386) has the molecular formula C16H20N6O4
and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate.
Molecular Properties
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
| PubChem CID | 7990386 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)Cn3cnnn3)CC2)cc1 |
| InChI | InChI=1S/C16H20N6O4/c1-25-14-4-2-13(3-5-14)20-6-8-21(9-7-20)15(23)11-26-16(24)10-22-12-17-18-19-22/h2-5,12H,6-11H2,1H3 |
| InChIKey | OTCSJFYMISHTQH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate?
The IUPAC name of [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate (CID 7990386) is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate.
What is the SMILES notation for [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate?
The canonical SMILES for [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate is COc1ccc(N2CCN(C(=O)COC(=O)Cn3cnnn3)CC2)cc1.
What is the InChIKey of [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate?
The InChIKey is OTCSJFYMISHTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6O4/c1-25-14-4-2-13(3-5-14)20-6-8-21(9-7-20)15(23)11-26-16(24)10-22-12-17-18-19-22/h2-5,12H,6-11H2,1H3.
What are the key properties of [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate?
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate has a molecular weight of 360.37 g/mol, XLogP of -0.43, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2-(tetrazol-1-yl)acetate is sourced from PubChem (CID 7990386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).