C20H24N2O4 — CID 55473337
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate (PubChem CID 55473337) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55473337 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 7-methoxy-2-methylquinoline-3-carboxylate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1cc2ccc(OC)cc2nc1C |
| InChI | InChI=1S/C20H24N2O4/c1-6-22(11-13(2)3)19(23)12-26-20(24)17-9-15-7-8-16(25-5)10-18(15)21-14(17)4/h7-10H,2,6,11-12H2,1,3-5H3 |
| InChIKey | UOUJAYOTMNOLHZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|