C22H30N2O4 — CID 37235447
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 6-methoxy-2-methylquinoline-3-carboxylate (PubChem CID 37235447) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 6-methoxy-2-methylquinoline-3-carboxylate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 6-methoxy-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 37235447 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 6-methoxy-2-methylquinoline-3-carboxylate |
| SMILES | COc1ccc2nc(C)c(C(=O)OCC(=O)N(CC(C)C)CC(C)C)cc2c1 |
| InChI | InChI=1S/C22H30N2O4/c1-14(2)11-24(12-15(3)4)21(25)13-28-22(26)19-10-17-9-18(27-6)7-8-20(17)23-16(19)5/h7-10,14-15H,11-13H2,1-6H3 |
| InChIKey | PGKNBRSXEBKNET-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |