C18H21ClN2O3 — CID 46676349
[2-(3-methylbutylamino)-2-oxoethyl] 6-chloro-2-methylquinoline-3-carboxylate (PubChem CID 46676349) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 6-chloro-2-methylquinoline-3-carboxylate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 6-chloro-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46676349 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 6-chloro-2-methylquinoline-3-carboxylate |
| SMILES | Cc1nc2ccc(Cl)cc2cc1C(=O)OCC(=O)NCCC(C)C |
| InChI | InChI=1S/C18H21ClN2O3/c1-11(2)6-7-20-17(22)10-24-18(23)15-9-13-8-14(19)4-5-16(13)21-12(15)3/h4-5,8-9,11H,6-7,10H2,1-3H3,(H,20,22) |
| InChIKey | AZHYIASQECMVOZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |