About (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate (PubChem CID 55475885) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate.
Molecular Properties
| Compound Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate |
| PubChem CID | 55475885 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate |
| SMILES | Cc1cccn2cc(COC(=O)COc3ccc(C(C)(C)C)cc3)nc12 |
| InChI | InChI=1S/C21H24N2O3/c1-15-6-5-11-23-12-17(22-20(15)23)13-26-19(24)14-25-18-9-7-16(8-10-18)21(2,3)4/h5-12H,13-14H2,1-4H3 |
| InChIKey | CRKFNALAWDRUGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate?
The IUPAC name of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate (CID 55475885) is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate.
What is the SMILES notation for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate?
The canonical SMILES for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate is Cc1cccn2cc(COC(=O)COc3ccc(C(C)(C)C)cc3)nc12.
What is the InChIKey of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate?
The InChIKey is CRKFNALAWDRUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-15-6-5-11-23-12-17(22-20(15)23)13-26-19(24)14-25-18-9-7-16(8-10-18)21(2,3)4/h5-12H,13-14H2,1-4H3.
What are the key properties of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate?
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate has a molecular weight of 352.43 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-tert-butylphenoxy)acetate is sourced from PubChem (CID 55475885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).