C22H27N3O3 — CID 122126907
2,2-dimethyl-4-[[4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methylamino]butanoic acid (PubChem CID 122126907) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methylamino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 122126907 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2,2-dimethyl-4-[[4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]methylamino]butanoic acid |
| SMILES | Cc1cccn2cc(COc3ccc(CNCCC(C)(C)C(=O)O)cc3)nc12 |
| InChI | InChI=1S/C22H27N3O3/c1-16-5-4-12-25-14-18(24-20(16)25)15-28-19-8-6-17(7-9-19)13-23-11-10-22(2,3)21(26)27/h4-9,12,14,23H,10-11,13,15H2,1-3H3,(H,26,27) |
| InChIKey | RXEXZRJPCKUKAY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|