C25H24FN3O3 — CID 16613165
N-[3-(2-fluorophenoxy)propyl]-4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide (PubChem CID 16613165) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 16613165 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
| SMILES | Cc1cccn2cc(COc3ccc(C(=O)NCCCOc4ccccc4F)cc3)nc12 |
| InChI | InChI=1S/C25H24FN3O3/c1-18-6-4-14-29-16-20(28-24(18)29)17-32-21-11-9-19(10-12-21)25(30)27-13-5-15-31-23-8-3-2-7-22(23)26/h2-4,6-12,14,16H,5,13,15,17H2,1H3,(H,27,30) |
| InChIKey | NIGRFDDVSIQKFM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|