C29H33N5O2 — CID 38447215
4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 38447215) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 38447215 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 4-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | Cc1cccn2cc(COc3ccc(C(=O)NCCCN4CCN(c5ccccc5)CC4)cc3)nc12 |
| InChI | InChI=1S/C29H33N5O2/c1-23-7-5-16-34-21-25(31-28(23)34)22-36-27-12-10-24(11-13-27)29(35)30-14-6-15-32-17-19-33(20-18-32)26-8-3-2-4-9-26/h2-5,7-13,16,21H,6,14-15,17-20,22H2,1H3,(H,30,35) |
| InChIKey | BHUWGXYDXJWVMV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|