C25H24N4O4 — CID 138044528
N-[2-[(4-hydroxybenzoyl)amino]ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide (PubChem CID 138044528) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[2-[(4-hydroxybenzoyl)amino]ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide.
| Compound Name | N-[2-[(4-hydroxybenzoyl)amino]ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 138044528 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[2-[(4-hydroxybenzoyl)amino]ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
| SMILES | Cc1cccn2cc(COc3ccccc3C(=O)NCCNC(=O)c3ccc(O)cc3)nc12 |
| InChI | InChI=1S/C25H24N4O4/c1-17-5-4-14-29-15-19(28-23(17)29)16-33-22-7-3-2-6-21(22)25(32)27-13-12-26-24(31)18-8-10-20(30)11-9-18/h2-11,14-15,30H,12-13,16H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | ZULXVZRRYOXYOA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|