C25H23N5O2S — CID 55635787
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide (PubChem CID 55635787) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 55635787 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
| SMILES | Cc1cccn2cc(COc3ccccc3C(=O)NCCNc3nc4ccccc4s3)nc12 |
| InChI | InChI=1S/C25H23N5O2S/c1-17-7-6-14-30-15-18(28-23(17)30)16-32-21-10-4-2-8-19(21)24(31)26-12-13-27-25-29-20-9-3-5-11-22(20)33-25/h2-11,14-15H,12-13,16H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | VPKXUYKZVYDVSB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|