C19H24Cl2N4O2 — CID 119502756
N-[2-(methylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide;dihydrochloride (PubChem CID 119502756) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119502756 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide;dihydrochloride |
| SMILES | CNCCNC(=O)c1ccccc1OCc1cn2cccc(C)c2n1.Cl.Cl |
| InChI | InChI=1S/C19H22N4O2.2ClH/c1-14-6-5-11-23-12-15(22-18(14)23)13-25-17-8-4-3-7-16(17)19(24)21-10-9-20-2;;/h3-8,11-12,20H,9-10,13H2,1-2H3,(H,21,24);2*1H |
| InChIKey | MHKTXWIOOHKJTJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|