C23H28ClNO4S — CID 55479704
(2-chloro-5-methylsulfonylphenyl)-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 55479704) has the molecular formula C23H28ClNO4S and a molecular weight of 450.00 g/mol. Its IUPAC name is (2-chloro-5-methylsulfonylphenyl)-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-methylsulfonylphenyl)-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55479704 |
| Molecular Formula | C23H28ClNO4S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (2-chloro-5-methylsulfonylphenyl)-[4-[2-(4-ethoxyphenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | CCOc1ccc(CCC2CCN(C(=O)c3cc(S(C)(=O)=O)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C23H28ClNO4S/c1-3-29-19-8-6-17(7-9-19)4-5-18-12-14-25(15-13-18)23(26)21-16-20(30(2,27)28)10-11-22(21)24/h6-11,16,18H,3-5,12-15H2,1-2H3 |
| InChIKey | SCRDQIWMYWVUNP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |