C27H30N4O2 — CID 55481060
N-[2-(3,5-dimethylphenyl)-5-methylpyrazol-3-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 55481060) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenyl)-5-methylpyrazol-3-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenyl)-5-methylpyrazol-3-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55481060 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[2-(3,5-dimethylphenyl)-5-methylpyrazol-3-yl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C)cc(-n2nc(C)cc2NC(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H30N4O2/c1-19-15-20(2)17-24(16-19)31-25(18-21(3)29-31)28-27(33)23-11-13-30(14-12-23)26(32)10-9-22-7-5-4-6-8-22/h4-10,15-18,23H,11-14H2,1-3H3,(H,28,33)/b10-9+ |
| InChIKey | RQEJOGIQUVGYTI-MDZDMXLPSA-N |
| XLogP | 4.69 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|