About [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate
[2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 55481805) has the molecular formula C26H26N2O4
and a molecular weight of 430.50 g/mol. Its IUPAC name is [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate.
Molecular Properties
| Compound Name | [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate |
| PubChem CID | 55481805 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCC(=O)N(Cc1ccccc1)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O4/c1-20(27-26(31)22-13-7-3-8-14-22)17-25(30)32-19-24(29)28(23-15-9-4-10-16-23)18-21-11-5-2-6-12-21/h2-16,20H,17-19H2,1H3,(H,27,31) |
| InChIKey | DPAJNQDBCDOGSX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate?
The IUPAC name of [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate (CID 55481805) is [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate.
What is the SMILES notation for [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate?
The canonical SMILES for [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate is CC(CC(=O)OCC(=O)N(Cc1ccccc1)c1ccccc1)NC(=O)c1ccccc1.
What is the InChIKey of [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate?
The InChIKey is DPAJNQDBCDOGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O4/c1-20(27-26(31)22-13-7-3-8-14-22)17-25(30)32-19-24(29)28(23-15-9-4-10-16-23)18-21-11-5-2-6-12-21/h2-16,20H,17-19H2,1H3,(H,27,31).
What are the key properties of [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate?
[2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate has a molecular weight of 430.50 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-benzylanilino)-2-oxoethyl] 3-benzamidobutanoate is sourced from PubChem (CID 55481805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).