C14H16Cl3NO3 — CID 54402612
3,3,3-trichloropropyl 3-benzamidobutanoate (PubChem CID 54402612) has the molecular formula C14H16Cl3NO3 and a molecular weight of 352.65 g/mol. Its IUPAC name is 3,3,3-trichloropropyl 3-benzamidobutanoate.
| Compound Name | 3,3,3-trichloropropyl 3-benzamidobutanoate |
|---|---|
| PubChem CID | 54402612 |
| Molecular Formula | C14H16Cl3NO3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 3,3,3-trichloropropyl 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCCC(Cl)(Cl)Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16Cl3NO3/c1-10(9-12(19)21-8-7-14(15,16)17)18-13(20)11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,18,20) |
| InChIKey | VOMLSSMZAONGAD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|