About 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate
2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate (PubChem CID 46819617) has the molecular formula C19H20ClNO4
and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate.
Molecular Properties
| Compound Name | 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate |
| PubChem CID | 46819617 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCCOc1cccc(Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20ClNO4/c1-14(21-19(23)15-6-3-2-4-7-15)12-18(22)25-11-10-24-17-9-5-8-16(20)13-17/h2-9,13-14H,10-12H2,1H3,(H,21,23) |
| InChIKey | QWYRJBPFDAZRKU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate?
The IUPAC name of 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate (CID 46819617) is 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate.
What is the SMILES notation for 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate?
The canonical SMILES for 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate is CC(CC(=O)OCCOc1cccc(Cl)c1)NC(=O)c1ccccc1.
What is the InChIKey of 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate?
The InChIKey is QWYRJBPFDAZRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClNO4/c1-14(21-19(23)15-6-3-2-4-7-15)12-18(22)25-11-10-24-17-9-5-8-16(20)13-17/h2-9,13-14H,10-12H2,1H3,(H,21,23).
What are the key properties of 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate?
2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate has a molecular weight of 361.83 g/mol, XLogP of 3.47, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenoxy)ethyl 3-benzamidobutanoate is sourced from PubChem (CID 46819617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).