C18H28N4O3 — CID 55482537
3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 55482537) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55482537 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CC(C)N(CCC(=O)Nc1ccc(N2CCOCC2)cc1)CC(N)=O |
| InChI | InChI=1S/C18H28N4O3/c1-14(2)22(13-17(19)23)8-7-18(24)20-15-3-5-16(6-4-15)21-9-11-25-12-10-21/h3-6,14H,7-13H2,1-2H3,(H2,19,23)(H,20,24) |
| InChIKey | DASZRRJFGGQYEV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|