C20H21N3OS — CID 55483189
(3-methyl-1-benzothiophen-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55483189) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is (3-methyl-1-benzothiophen-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3-methyl-1-benzothiophen-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55483189 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (3-methyl-1-benzothiophen-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(Cc3cccnc3)CC2)sc2ccccc12 |
| InChI | InChI=1S/C20H21N3OS/c1-15-17-6-2-3-7-18(17)25-19(15)20(24)23-11-9-22(10-12-23)14-16-5-4-8-21-13-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | UEWPGUDQBRUGEY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |