C18H16ClF3N2O4 — CID 55484582
[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,2,2-trifluoroethoxymethyl)benzoate (PubChem CID 55484582) has the molecular formula C18H16ClF3N2O4 and a molecular weight of 416.78 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,2,2-trifluoroethoxymethyl)benzoate.
| Compound Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,2,2-trifluoroethoxymethyl)benzoate |
|---|---|
| PubChem CID | 55484582 |
| Molecular Formula | C18H16ClF3N2O4 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4-(2,2,2-trifluoroethoxymethyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(COCC(F)(F)F)cc1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C18H16ClF3N2O4/c1-11(16(25)24-14-3-2-8-23-15(14)19)28-17(26)13-6-4-12(5-7-13)9-27-10-18(20,21)22/h2-8,11H,9-10H2,1H3,(H,24,25) |
| InChIKey | UNPYLGPDHWVWKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|