C20H15N3O6 — CID 55487975
1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55487975) has the molecular formula C20H15N3O6 and a molecular weight of 393.36 g/mol. Its IUPAC name is 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55487975 |
| Molecular Formula | C20H15N3O6 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | CC(OC(=O)COc1ccc2ccc(=O)oc2c1)c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C20H15N3O6/c1-12(20-22-19(23-29-20)14-3-2-8-21-10-14)27-18(25)11-26-15-6-4-13-5-7-17(24)28-16(13)9-15/h2-10,12H,11H2,1H3 |
| InChIKey | XRTVLEBGIDHJBA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|