About 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate (PubChem CID 55491816) has the molecular formula C23H22F2N2O3
and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate.
Molecular Properties
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate |
| PubChem CID | 55491816 |
| Molecular Formula | C23H22F2N2O3 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate |
| SMILES | CC(OC(=O)CCC(=O)c1ccc2c(c1)CCC2)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C23H22F2N2O3/c1-14(22-26-18-7-2-3-8-19(18)27(22)23(24)25)30-21(29)12-11-20(28)17-10-9-15-5-4-6-16(15)13-17/h2-3,7-10,13-14,23H,4-6,11-12H2,1H3 |
| InChIKey | ODMBCNFZHUVFGB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate?
The IUPAC name of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate (CID 55491816) is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate.
What is the SMILES notation for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate?
The canonical SMILES for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate is CC(OC(=O)CCC(=O)c1ccc2c(c1)CCC2)c1nc2ccccc2n1C(F)F.
What is the InChIKey of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate?
The InChIKey is ODMBCNFZHUVFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2N2O3/c1-14(22-26-18-7-2-3-8-19(18)27(22)23(24)25)30-21(29)12-11-20(28)17-10-9-15-5-4-6-16(15)13-17/h2-3,7-10,13-14,23H,4-6,11-12H2,1H3.
What are the key properties of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate?
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate has a molecular weight of 412.44 g/mol, XLogP of 5.19, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanoate is sourced from PubChem (CID 55491816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).