C18H21Cl2N3O4S — CID 55494607
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 55494607) has the molecular formula C18H21Cl2N3O4S and a molecular weight of 446.36 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 55494607 |
| Molecular Formula | C18H21Cl2N3O4S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)N(C(=O)CCc1ncc(-c2ccc(Cl)cc2Cl)o1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21Cl2N3O4S/c1-22(2)23(13-7-8-28(25,26)11-13)18(24)6-5-17-21-10-16(27-17)14-4-3-12(19)9-15(14)20/h3-4,9-10,13H,5-8,11H2,1-2H3 |
| InChIKey | IWWOOOKLIWWETF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|