C21H27ClN4O3S — CID 55494890
2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 55494890) has the molecular formula C21H27ClN4O3S and a molecular weight of 450.99 g/mol. Its IUPAC name is 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 55494890 |
| Molecular Formula | C21H27ClN4O3S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCCNC(=O)c1c(NC(=O)/C=C/c2c(C)nn(C)c2Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C21H27ClN4O3S/c1-13-14(19(22)26(2)25-13)9-10-17(27)24-21-18(20(28)23-11-6-12-29-3)15-7-4-5-8-16(15)30-21/h9-10H,4-8,11-12H2,1-3H3,(H,23,28)(H,24,27)/b10-9+ |
| InChIKey | DEFQVMCFVXKPRV-MDZDMXLPSA-N |
| XLogP | 3.74 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|