C21H16ClFN4O — CID 55498739
5-chloro-1-[(4-fluorophenyl)methyl]-3-methyl-N-quinolin-8-ylpyrazole-4-carboxamide (PubChem CID 55498739) has the molecular formula C21H16ClFN4O and a molecular weight of 394.84 g/mol. Its IUPAC name is 5-chloro-1-[(4-fluorophenyl)methyl]-3-methyl-N-quinolin-8-ylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-[(4-fluorophenyl)methyl]-3-methyl-N-quinolin-8-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55498739 |
| Molecular Formula | C21H16ClFN4O |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-chloro-1-[(4-fluorophenyl)methyl]-3-methyl-N-quinolin-8-ylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C21H16ClFN4O/c1-13-18(20(22)27(26-13)12-14-7-9-16(23)10-8-14)21(28)25-17-6-2-4-15-5-3-11-24-19(15)17/h2-11H,12H2,1H3,(H,25,28) |
| InChIKey | QGUOESNENLSFAS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |