C22H25N3O3S — CID 55501090
N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-methoxybenzenecarboximidamide (PubChem CID 55501090) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-methoxybenzenecarboximidamide.
| Compound Name | N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 55501090 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccccc1/C(N)=N/OCC(=O)c1cc(C)n(CCc2cccs2)c1C |
| InChI | InChI=1S/C22H25N3O3S/c1-15-13-19(16(2)25(15)11-10-17-7-6-12-29-17)20(26)14-28-24-22(23)18-8-4-5-9-21(18)27-3/h4-9,12-13H,10-11,14H2,1-3H3,(H2,23,24) |
| InChIKey | UWSLPRAPXXMRKT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|