C20H24N4O2S2 — CID 78903928
N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide (PubChem CID 78903928) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide.
| Compound Name | N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 78903928 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N'-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]-2-(4-methyl-1,3-thiazol-2-yl)ethanimidamide |
| SMILES | Cc1csc(C/C(N)=N/OCC(=O)c2cc(C)n(CCc3cccs3)c2C)n1 |
| InChI | InChI=1S/C20H24N4O2S2/c1-13-12-28-20(22-13)10-19(21)23-26-11-18(25)17-9-14(2)24(15(17)3)7-6-16-5-4-8-27-16/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H2,21,23) |
| InChIKey | SZQMICSSERZUFF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|