C23H21NO4S — CID 8536228
7-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 8536228) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is 7-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 8536228 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 7-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(C(=O)COc2ccc3ccc(=O)oc3c2)c(C)n1CCc1cccs1 |
| InChI | InChI=1S/C23H21NO4S/c1-15-12-20(16(2)24(15)10-9-19-4-3-11-29-19)21(25)14-27-18-7-5-17-6-8-23(26)28-22(17)13-18/h3-8,11-13H,9-10,14H2,1-2H3 |
| InChIKey | LWNBXBUFTDWWPF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|