C24H21N7O4 — CID 55502737
6-(furan-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55502737) has the molecular formula C24H21N7O4 and a molecular weight of 471.48 g/mol. Its IUPAC name is 6-(furan-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(furan-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55502737 |
| Molecular Formula | C24H21N7O4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 6-(furan-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(-c3ccco3)nc3c2cnn3C(C)C)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C24H21N7O4/c1-14(2)29-23-19(13-25-29)18(12-20(26-23)21-5-4-10-35-21)24(32)27-22-11-15(3)28-30(22)16-6-8-17(9-7-16)31(33)34/h4-14H,1-3H3,(H,27,32) |
| InChIKey | OGMJGVSGTSDRON-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|