C18H22N4O4 — CID 55503441
[1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-(pyrazol-1-ylmethyl)benzoate (PubChem CID 55503441) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-(pyrazol-1-ylmethyl)benzoate.
| Compound Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-(pyrazol-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 55503441 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 4-(pyrazol-1-ylmethyl)benzoate |
| SMILES | CC(C)NC(=O)NC(=O)C(C)OC(=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-12(2)20-18(25)21-16(23)13(3)26-17(24)15-7-5-14(6-8-15)11-22-10-4-9-19-22/h4-10,12-13H,11H2,1-3H3,(H2,20,21,23,25) |
| InChIKey | IBEZWZWTTNMOHW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |