C12H16N2O5 — CID 46649045
[1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] furan-3-carboxylate (PubChem CID 46649045) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] furan-3-carboxylate.
| Compound Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 46649045 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] furan-3-carboxylate |
| SMILES | CC(C)NC(=O)NC(=O)C(C)OC(=O)c1ccoc1 |
| InChI | InChI=1S/C12H16N2O5/c1-7(2)13-12(17)14-10(15)8(3)19-11(16)9-4-5-18-6-9/h4-8H,1-3H3,(H2,13,14,15,17) |
| InChIKey | LNSCYOCYNHKFRG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |