C24H27N3O2S2 — CID 55505673
N-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[(4-morpholin-4-ylphenyl)methyl]benzamide (PubChem CID 55505673) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[(4-morpholin-4-ylphenyl)methyl]benzamide.
| Compound Name | N-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55505673 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
| SMILES | Cc1nc(CSc2ccccc2C(=O)N(C)Cc2ccc(N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C24H27N3O2S2/c1-18-25-20(16-30-18)17-31-23-6-4-3-5-22(23)24(28)26(2)15-19-7-9-21(10-8-19)27-11-13-29-14-12-27/h3-10,16H,11-15,17H2,1-2H3 |
| InChIKey | NREXAWPFWDRYEO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|